About (Z)-2-(2,2,4-trimethylhexan-3-ylideneamino)ethenamine
(Z)-2-(2,2,4-trimethylhexan-3-ylideneamino)ethenamine (PubChem CID 155223143) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is (Z)-2-(2,2,4-trimethylhexan-3-ylideneamino)ethenamine.
Molecular Properties
| Compound Name | (Z)-2-(2,2,4-trimethylhexan-3-ylideneamino)ethenamine |
| PubChem CID | 155223143 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | (Z)-2-(2,2,4-trimethylhexan-3-ylideneamino)ethenamine |
| SMILES | CCC(C)/C(=N\C=C/N)C(C)(C)C |
| InChI | InChI=1S/C11H22N2/c1-6-9(2)10(11(3,4)5)13-8-7-12/h7-9H,6,12H2,1-5H3/b8-7-,13-10+ |
| InChIKey | QHCMJBACPAZWBS-BRSIODNASA-N |
| XLogP | 2.95 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-(2,2,4-trimethylhexan-3-ylideneamino)ethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-(2,2,4-trimethylhexan-3-ylideneamino)ethenamine?
The IUPAC name of (Z)-2-(2,2,4-trimethylhexan-3-ylideneamino)ethenamine (CID 155223143) is (Z)-2-(2,2,4-trimethylhexan-3-ylideneamino)ethenamine.
What is the SMILES notation for (Z)-2-(2,2,4-trimethylhexan-3-ylideneamino)ethenamine?
The canonical SMILES for (Z)-2-(2,2,4-trimethylhexan-3-ylideneamino)ethenamine is CCC(C)/C(=N\C=C/N)C(C)(C)C.
What is the InChIKey of (Z)-2-(2,2,4-trimethylhexan-3-ylideneamino)ethenamine?
The InChIKey is QHCMJBACPAZWBS-BRSIODNASA-N. The full InChI is InChI=1S/C11H22N2/c1-6-9(2)10(11(3,4)5)13-8-7-12/h7-9H,6,12H2,1-5H3/b8-7-,13-10+.
What are the key properties of (Z)-2-(2,2,4-trimethylhexan-3-ylideneamino)ethenamine?
(Z)-2-(2,2,4-trimethylhexan-3-ylideneamino)ethenamine has a molecular weight of 182.31 g/mol, XLogP of 2.95, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(2,2,4-trimethylhexan-3-ylideneamino)ethenamine is sourced from PubChem (CID 155223143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).