C11H22N2 — CID 155223143
(Z)-2-(2,2,4-trimethylhexan-3-ylideneamino)ethenamine (PubChem CID 155223143) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is (Z)-2-(2,2,4-trimethylhexan-3-ylideneamino)ethenamine.
| Compound Name | (Z)-2-(2,2,4-trimethylhexan-3-ylideneamino)ethenamine |
|---|---|
| PubChem CID | 155223143 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | (Z)-2-(2,2,4-trimethylhexan-3-ylideneamino)ethenamine |
| SMILES | CCC(C)/C(=N\C=C/N)C(C)(C)C |
| InChI | InChI=1S/C11H22N2/c1-6-9(2)10(11(3,4)5)13-8-7-12/h7-9H,6,12H2,1-5H3/b8-7-,13-10+ |
| InChIKey | QHCMJBACPAZWBS-BRSIODNASA-N |
| XLogP | 2.95 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|