C16H22F2N2O2 — CID 155229608
2-tert-butyl-4-(3,4-difluorophenyl)-1,4-diazepane-1-carboxylic acid (PubChem CID 155229608) has the molecular formula C16H22F2N2O2 and a molecular weight of 312.36 g/mol. Its IUPAC name is 2-tert-butyl-4-(3,4-difluorophenyl)-1,4-diazepane-1-carboxylic acid.
| Compound Name | 2-tert-butyl-4-(3,4-difluorophenyl)-1,4-diazepane-1-carboxylic acid |
|---|---|
| PubChem CID | 155229608 |
| Molecular Formula | C16H22F2N2O2 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 2-tert-butyl-4-(3,4-difluorophenyl)-1,4-diazepane-1-carboxylic acid |
| SMILES | CC(C)(C)C1CN(c2ccc(F)c(F)c2)CCCN1C(=O)O |
| InChI | InChI=1S/C16H22F2N2O2/c1-16(2,3)14-10-19(7-4-8-20(14)15(21)22)11-5-6-12(17)13(18)9-11/h5-6,9,14H,4,7-8,10H2,1-3H3,(H,21,22) |
| InChIKey | XUGFNNLBEKXSIY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |