C33H23BrN5P — CID 155236843
5-bromo-3-(4,6-diphenyl-1,3,5-triazin-2-yl)-1,2-diphenyl-1,3,2-benzodiazaphosphole (PubChem CID 155236843) has the molecular formula C33H23BrN5P and a molecular weight of 600.46 g/mol. Its IUPAC name is 5-bromo-3-(4,6-diphenyl-1,3,5-triazin-2-yl)-1,2-diphenyl-1,3,2-benzodiazaphosphole.
| Compound Name | 5-bromo-3-(4,6-diphenyl-1,3,5-triazin-2-yl)-1,2-diphenyl-1,3,2-benzodiazaphosphole |
|---|---|
| PubChem CID | 155236843 |
| Molecular Formula | C33H23BrN5P |
| Molecular Weight | 600.46 g/mol |
| Exact Mass | 599.09 |
| IUPAC Name | 5-bromo-3-(4,6-diphenyl-1,3,5-triazin-2-yl)-1,2-diphenyl-1,3,2-benzodiazaphosphole |
| SMILES | Brc1ccc2c(c1)N(c1nc(-c3ccccc3)nc(-c3ccccc3)n1)P(c1ccccc1)N2c1ccccc1 |
| InChI | InChI=1S/C33H23BrN5P/c34-26-21-22-29-30(23-26)39(40(28-19-11-4-12-20-28)38(29)27-17-9-3-10-18-27)33-36-31(24-13-5-1-6-14-24)35-32(37-33)25-15-7-2-8-16-25/h1-23H |
| InChIKey | UFIBPKCLFYMHDC-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.46 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|