C13H27NO — CID 155244293
(2R,5R)-N,2-diethyl-5,6-dimethylheptanamide (PubChem CID 155244293) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is (2R,5R)-N,2-diethyl-5,6-dimethylheptanamide.
| Compound Name | (2R,5R)-N,2-diethyl-5,6-dimethylheptanamide |
|---|---|
| PubChem CID | 155244293 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | (2R,5R)-N,2-diethyl-5,6-dimethylheptanamide |
| SMILES | CCNC(=O)C(CC)CC[C@@H](C)C(C)C |
| InChI | InChI=1S/C13H27NO/c1-6-12(13(15)14-7-2)9-8-11(5)10(3)4/h10-12H,6-9H2,1-5H3,(H,14,15)/t11-,12?/m1/s1 |
| InChIKey | BBOLGUNQLDRFLV-JHJMLUEUSA-N |
| XLogP | 3.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |