C8H17NOS — CID 87450544
N,2-diethyl-4-sulfanylbutanamide (PubChem CID 87450544) has the molecular formula C8H17NOS and a molecular weight of 175.30 g/mol. Its IUPAC name is N,2-diethyl-4-sulfanylbutanamide.
| Compound Name | N,2-diethyl-4-sulfanylbutanamide |
|---|---|
| PubChem CID | 87450544 |
| Molecular Formula | C8H17NOS |
| Molecular Weight | 175.30 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | N,2-diethyl-4-sulfanylbutanamide |
| SMILES | CCNC(=O)C(CC)CCS |
| InChI | InChI=1S/C8H17NOS/c1-3-7(5-6-11)8(10)9-4-2/h7,11H,3-6H2,1-2H3,(H,9,10) |
| InChIKey | JRMYTRZPBDMKAK-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|