C12H19NO — CID 155244660
N-(4-methylcyclohexa-1,3-dien-1-yl)oxan-2-amine (PubChem CID 155244660) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is N-(4-methylcyclohexa-1,3-dien-1-yl)oxan-2-amine.
| Compound Name | N-(4-methylcyclohexa-1,3-dien-1-yl)oxan-2-amine |
|---|---|
| PubChem CID | 155244660 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | N-(4-methylcyclohexa-1,3-dien-1-yl)oxan-2-amine |
| SMILES | CC1=CC=C(NC2CCCCO2)CC1 |
| InChI | InChI=1S/C12H19NO/c1-10-5-7-11(8-6-10)13-12-4-2-3-9-14-12/h5,7,12-13H,2-4,6,8-9H2,1H3 |
| InChIKey | HNLVJODRLRRCOP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |