About N-(4-methylcyclohexa-1,3-dien-1-yl)oxan-2-amine
N-(4-methylcyclohexa-1,3-dien-1-yl)oxan-2-amine (PubChem CID 155244660) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is N-(4-methylcyclohexa-1,3-dien-1-yl)oxan-2-amine.
Molecular Properties
| Compound Name | N-(4-methylcyclohexa-1,3-dien-1-yl)oxan-2-amine |
| PubChem CID | 155244660 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | N-(4-methylcyclohexa-1,3-dien-1-yl)oxan-2-amine |
| SMILES | CC1=CC=C(NC2CCCCO2)CC1 |
| InChI | InChI=1S/C12H19NO/c1-10-5-7-11(8-6-10)13-12-4-2-3-9-14-12/h5,7,12-13H,2-4,6,8-9H2,1H3 |
| InChIKey | HNLVJODRLRRCOP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(4-methylcyclohexa-1,3-dien-1-yl)oxan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methylcyclohexa-1,3-dien-1-yl)oxan-2-amine?
The IUPAC name of N-(4-methylcyclohexa-1,3-dien-1-yl)oxan-2-amine (CID 155244660) is N-(4-methylcyclohexa-1,3-dien-1-yl)oxan-2-amine.
What is the SMILES notation for N-(4-methylcyclohexa-1,3-dien-1-yl)oxan-2-amine?
The canonical SMILES for N-(4-methylcyclohexa-1,3-dien-1-yl)oxan-2-amine is CC1=CC=C(NC2CCCCO2)CC1.
What is the InChIKey of N-(4-methylcyclohexa-1,3-dien-1-yl)oxan-2-amine?
The InChIKey is HNLVJODRLRRCOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO/c1-10-5-7-11(8-6-10)13-12-4-2-3-9-14-12/h5,7,12-13H,2-4,6,8-9H2,1H3.
What are the key properties of N-(4-methylcyclohexa-1,3-dien-1-yl)oxan-2-amine?
N-(4-methylcyclohexa-1,3-dien-1-yl)oxan-2-amine has a molecular weight of 193.29 g/mol, XLogP of 2.73, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methylcyclohexa-1,3-dien-1-yl)oxan-2-amine is sourced from PubChem (CID 155244660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).