C13H21NO — CID 153334024
(3Z)-5-methyl-N-(oxan-3-ylmethyl)hexa-1,3,5-trien-2-amine (PubChem CID 153334024) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is (3Z)-5-methyl-N-(oxan-3-ylmethyl)hexa-1,3,5-trien-2-amine.
| Compound Name | (3Z)-5-methyl-N-(oxan-3-ylmethyl)hexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 153334024 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (3Z)-5-methyl-N-(oxan-3-ylmethyl)hexa-1,3,5-trien-2-amine |
| SMILES | C=C(C)/C=C\C(=C)NCC1CCCOC1 |
| InChI | InChI=1S/C13H21NO/c1-11(2)6-7-12(3)14-9-13-5-4-8-15-10-13/h6-7,13-14H,1,3-5,8-10H2,2H3/b7-6- |
| InChIKey | QUKANMBFXVDPIA-SREVYHEPSA-N |
| XLogP | 2.65 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|