C10H13BrN2S — CID 155247382
3-(2-bromo-1,3-thiazol-5-yl)-4-methylhexanenitrile (PubChem CID 155247382) has the molecular formula C10H13BrN2S and a molecular weight of 273.20 g/mol. Its IUPAC name is 3-(2-bromo-1,3-thiazol-5-yl)-4-methylhexanenitrile.
| Compound Name | 3-(2-bromo-1,3-thiazol-5-yl)-4-methylhexanenitrile |
|---|---|
| PubChem CID | 155247382 |
| Molecular Formula | C10H13BrN2S |
| Molecular Weight | 273.20 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | 3-(2-bromo-1,3-thiazol-5-yl)-4-methylhexanenitrile |
| SMILES | CCC(C)C(CC#N)c1cnc(Br)s1 |
| InChI | InChI=1S/C10H13BrN2S/c1-3-7(2)8(4-5-12)9-6-13-10(11)14-9/h6-8H,3-4H2,1-2H3 |
| InChIKey | JUNIBRGKTXNTMI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.20 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |