C6H8BrNO2S — CID 134387990
(2-bromo-1,3-thiazol-5-yl)-ethoxymethanol (PubChem CID 134387990) has the molecular formula C6H8BrNO2S and a molecular weight of 238.11 g/mol. Its IUPAC name is (2-bromo-1,3-thiazol-5-yl)-ethoxymethanol.
| Compound Name | (2-bromo-1,3-thiazol-5-yl)-ethoxymethanol |
|---|---|
| PubChem CID | 134387990 |
| Molecular Formula | C6H8BrNO2S |
| Molecular Weight | 238.11 g/mol |
| Exact Mass | 236.95 |
| IUPAC Name | (2-bromo-1,3-thiazol-5-yl)-ethoxymethanol |
| SMILES | CCOC(O)c1cnc(Br)s1 |
| InChI | InChI=1S/C6H8BrNO2S/c1-2-10-5(9)4-3-8-6(7)11-4/h3,5,9H,2H2,1H3 |
| InChIKey | ACXJRFNOECCBAN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.11 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|