C16H13ClN2O5S — CID 155176302
6-chloro-N-[5-[ethoxy(hydroxy)methyl]-1,3-thiazol-2-yl]-2-oxochromene-3-carboxamide (PubChem CID 155176302) has the molecular formula C16H13ClN2O5S and a molecular weight of 380.81 g/mol. Its IUPAC name is 6-chloro-N-[5-[ethoxy(hydroxy)methyl]-1,3-thiazol-2-yl]-2-oxochromene-3-carboxamide.
| Compound Name | 6-chloro-N-[5-[ethoxy(hydroxy)methyl]-1,3-thiazol-2-yl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 155176302 |
| Molecular Formula | C16H13ClN2O5S |
| Molecular Weight | 380.81 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 6-chloro-N-[5-[ethoxy(hydroxy)methyl]-1,3-thiazol-2-yl]-2-oxochromene-3-carboxamide |
| SMILES | CCOC(O)c1cnc(NC(=O)c2cc3cc(Cl)ccc3oc2=O)s1 |
| InChI | InChI=1S/C16H13ClN2O5S/c1-2-23-15(22)12-7-18-16(25-12)19-13(20)10-6-8-5-9(17)3-4-11(8)24-14(10)21/h3-7,15,22H,2H2,1H3,(H,18,19,20) |
| InChIKey | ROQFPZSKNJTFOW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.81 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|