C20H12ClFN2O3S — CID 4312248
6-chloro-N-[5-[(2-fluorophenyl)methyl]-1,3-thiazol-2-yl]-2-oxochromene-3-carboxamide (PubChem CID 4312248) has the molecular formula C20H12ClFN2O3S and a molecular weight of 414.85 g/mol. Its IUPAC name is 6-chloro-N-[5-[(2-fluorophenyl)methyl]-1,3-thiazol-2-yl]-2-oxochromene-3-carboxamide.
| Compound Name | 6-chloro-N-[5-[(2-fluorophenyl)methyl]-1,3-thiazol-2-yl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 4312248 |
| Molecular Formula | C20H12ClFN2O3S |
| Molecular Weight | 414.85 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | 6-chloro-N-[5-[(2-fluorophenyl)methyl]-1,3-thiazol-2-yl]-2-oxochromene-3-carboxamide |
| SMILES | O=C(Nc1ncc(Cc2ccccc2F)s1)c1cc2cc(Cl)ccc2oc1=O |
| InChI | InChI=1S/C20H12ClFN2O3S/c21-13-5-6-17-12(7-13)9-15(19(26)27-17)18(25)24-20-23-10-14(28-20)8-11-3-1-2-4-16(11)22/h1-7,9-10H,8H2,(H,23,24,25) |
| InChIKey | YGMUCNDPHCEXFN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.85 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|