C24H50N2 — CID 155248592
1,1,2-trimethyl-2-(17-methylideneicosan-8-yl)hydrazine (PubChem CID 155248592) has the molecular formula C24H50N2 and a molecular weight of 366.68 g/mol. Its IUPAC name is 1,1,2-trimethyl-2-(17-methylideneicosan-8-yl)hydrazine.
| Compound Name | 1,1,2-trimethyl-2-(17-methylideneicosan-8-yl)hydrazine |
|---|---|
| PubChem CID | 155248592 |
| Molecular Formula | C24H50N2 |
| Molecular Weight | 366.68 g/mol |
| Exact Mass | 366.40 |
| IUPAC Name | 1,1,2-trimethyl-2-(17-methylideneicosan-8-yl)hydrazine |
| SMILES | C=C(CCC)CCCCCCCCC(CCCCCCC)N(C)N(C)C |
| InChI | InChI=1S/C24H50N2/c1-7-9-10-13-17-21-24(26(6)25(4)5)22-18-15-12-11-14-16-20-23(3)19-8-2/h24H,3,7-22H2,1-2,4-6H3 |
| InChIKey | CHQDJWRWEADWBA-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.68 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|