C10H11F2NO4 — CID 155250759
[1-(3,5-difluorophenyl)-3-hydroxypropyl]-hydroxycarbamic acid (PubChem CID 155250759) has the molecular formula C10H11F2NO4 and a molecular weight of 247.20 g/mol. Its IUPAC name is [1-(3,5-difluorophenyl)-3-hydroxypropyl]-hydroxycarbamic acid.
| Compound Name | [1-(3,5-difluorophenyl)-3-hydroxypropyl]-hydroxycarbamic acid |
|---|---|
| PubChem CID | 155250759 |
| Molecular Formula | C10H11F2NO4 |
| Molecular Weight | 247.20 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | [1-(3,5-difluorophenyl)-3-hydroxypropyl]-hydroxycarbamic acid |
| SMILES | O=C(O)N(O)C(CCO)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C10H11F2NO4/c11-7-3-6(4-8(12)5-7)9(1-2-14)13(17)10(15)16/h3-5,9,14,17H,1-2H2,(H,15,16) |
| InChIKey | JJCXDVSWKLFSHU-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.20 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|