C26H28F4N6O2 — CID 155251994
5-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-N-[(3R,4S)-1-(2-cyclopentylacetyl)-4-fluoropyrrolidin-3-yl]-2-methylbenzamide (PubChem CID 155251994) has the molecular formula C26H28F4N6O2 and a molecular weight of 532.54 g/mol. Its IUPAC name is 5-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-N-[(3R,4S)-1-(2-cyclopentylacetyl)-4-fluoropyrrolidin-3-yl]-2-methylbenzamide.
| Compound Name | 5-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-N-[(3R,4S)-1-(2-cyclopentylacetyl)-4-fluoropyrrolidin-3-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 155251994 |
| Molecular Formula | C26H28F4N6O2 |
| Molecular Weight | 532.54 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | 5-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-N-[(3R,4S)-1-(2-cyclopentylacetyl)-4-fluoropyrrolidin-3-yl]-2-methylbenzamide |
| SMILES | Cc1ccc(-c2cc(C(F)(F)F)c3c(N)ncnn23)cc1C(=O)N[C@@H]1CN(C(=O)CC2CCCC2)C[C@@H]1F |
| InChI | InChI=1S/C26H28F4N6O2/c1-14-6-7-16(21-10-18(26(28,29)30)23-24(31)32-13-33-36(21)23)9-17(14)25(38)34-20-12-35(11-19(20)27)22(37)8-15-4-2-3-5-15/h6-7,9-10,13,15,19-20H,2-5,8,11-12H2,1H3,(H,34,38)(H2,31,32,33)/t19-,20+/m0/s1 |
| InChIKey | JBFSLOSBBDTTGQ-VQTJNVASSA-N |
| XLogP | 4.16 |
| TPSA | 105.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.54 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |