C25H23F7N6O2 — CID 155253032
5-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-N-[(3R,4S)-1-(4,4-difluorocyclohexanecarbonyl)-4-fluoropyrrolidin-3-yl]-2-fluorobenzamide (PubChem CID 155253032) has the molecular formula C25H23F7N6O2 and a molecular weight of 572.49 g/mol. Its IUPAC name is 5-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-N-[(3R,4S)-1-(4,4-difluorocyclohexanecarbonyl)-4-fluoropyrrolidin-3-yl]-2-fluorobenzamide.
| Compound Name | 5-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-N-[(3R,4S)-1-(4,4-difluorocyclohexanecarbonyl)-4-fluoropyrrolidin-3-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 155253032 |
| Molecular Formula | C25H23F7N6O2 |
| Molecular Weight | 572.49 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | 5-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-N-[(3R,4S)-1-(4,4-difluorocyclohexanecarbonyl)-4-fluoropyrrolidin-3-yl]-2-fluorobenzamide |
| SMILES | Nc1ncnn2c(-c3ccc(F)c(C(=O)N[C@@H]4CN(C(=O)C5CCC(F)(F)CC5)C[C@@H]4F)c3)cc(C(F)(F)F)c12 |
| InChI | InChI=1S/C25H23F7N6O2/c26-16-2-1-13(19-8-15(25(30,31)32)20-21(33)34-11-35-38(19)20)7-14(16)22(39)36-18-10-37(9-17(18)27)23(40)12-3-5-24(28,29)6-4-12/h1-2,7-8,11-12,17-18H,3-6,9-10H2,(H,36,39)(H2,33,34,35)/t17-,18+/m0/s1 |
| InChIKey | ZUHXTSCAVPXMAB-ZWKOTPCHSA-N |
| XLogP | 4.24 |
| TPSA | 105.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |