C23H19ClF6N6O2 — CID 155252248
5-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-chloro-N-[(3R,4S)-1-(3,3-difluorocyclobutanecarbonyl)-4-fluoropyrrolidin-3-yl]benzamide (PubChem CID 155252248) has the molecular formula C23H19ClF6N6O2 and a molecular weight of 560.89 g/mol. Its IUPAC name is 5-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-chloro-N-[(3R,4S)-1-(3,3-difluorocyclobutanecarbonyl)-4-fluoropyrrolidin-3-yl]benzamide.
| Compound Name | 5-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-chloro-N-[(3R,4S)-1-(3,3-difluorocyclobutanecarbonyl)-4-fluoropyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 155252248 |
| Molecular Formula | C23H19ClF6N6O2 |
| Molecular Weight | 560.89 g/mol |
| Exact Mass | 560.12 |
| IUPAC Name | 5-[4-amino-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-chloro-N-[(3R,4S)-1-(3,3-difluorocyclobutanecarbonyl)-4-fluoropyrrolidin-3-yl]benzamide |
| SMILES | Nc1ncnn2c(-c3ccc(Cl)c(C(=O)N[C@@H]4CN(C(=O)C5CC(F)(F)C5)C[C@@H]4F)c3)cc(C(F)(F)F)c12 |
| InChI | InChI=1S/C23H19ClF6N6O2/c24-14-2-1-10(17-4-13(23(28,29)30)18-19(31)32-9-33-36(17)18)3-12(14)20(37)34-16-8-35(7-15(16)25)21(38)11-5-22(26,27)6-11/h1-4,9,11,15-16H,5-8H2,(H,34,37)(H2,31,32,33)/t15-,16+/m0/s1 |
| InChIKey | LXFSSANKPUZIEG-JKSUJKDBSA-N |
| XLogP | 3.97 |
| TPSA | 105.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.89 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |