C28H50O4 — CID 155254575
(E)-4-(1,2,2,3,3,4,4,5,5-nonaethylcyclohexyl)oxy-4-oxobut-2-enoic acid (PubChem CID 155254575) has the molecular formula C28H50O4 and a molecular weight of 450.70 g/mol. Its IUPAC name is (E)-4-(1,2,2,3,3,4,4,5,5-nonaethylcyclohexyl)oxy-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-(1,2,2,3,3,4,4,5,5-nonaethylcyclohexyl)oxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 155254575 |
| Molecular Formula | C28H50O4 |
| Molecular Weight | 450.70 g/mol |
| Exact Mass | 450.37 |
| IUPAC Name | (E)-4-(1,2,2,3,3,4,4,5,5-nonaethylcyclohexyl)oxy-4-oxobut-2-enoic acid |
| SMILES | CCC1(CC)CC(CC)(OC(=O)/C=C/C(=O)O)C(CC)(CC)C(CC)(CC)C1(CC)CC |
| InChI | InChI=1S/C28H50O4/c1-10-24(11-2)21-28(18-9,32-23(31)20-19-22(29)30)27(16-7,17-8)26(14-5,15-6)25(24,12-3)13-4/h19-20H,10-18,21H2,1-9H3,(H,29,30)/b20-19+ |
| InChIKey | HRMCHZIAGDUCCI-FMQUCBEESA-N |
| XLogP | 7.95 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.70 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|