C13H8ClFN2 — CID 155255024
2-(4-chlorophenyl)-5-fluoroimidazo[1,2-a]pyridine (PubChem CID 155255024) has the molecular formula C13H8ClFN2 and a molecular weight of 246.67 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5-fluoroimidazo[1,2-a]pyridine.
| Compound Name | 2-(4-chlorophenyl)-5-fluoroimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 155255024 |
| Molecular Formula | C13H8ClFN2 |
| Molecular Weight | 246.67 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | 2-(4-chlorophenyl)-5-fluoroimidazo[1,2-a]pyridine |
| SMILES | Fc1cccc2nc(-c3ccc(Cl)cc3)cn12 |
| InChI | InChI=1S/C13H8ClFN2/c14-10-6-4-9(5-7-10)11-8-17-12(15)2-1-3-13(17)16-11/h1-8H |
| InChIKey | JJJHHLNNHNWUNI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.67 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|