C15H10ClN3 — CID 166473715
11-(4-chlorophenyl)-1,5,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 166473715) has the molecular formula C15H10ClN3 and a molecular weight of 267.72 g/mol. Its IUPAC name is 11-(4-chlorophenyl)-1,5,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 11-(4-chlorophenyl)-1,5,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 166473715 |
| Molecular Formula | C15H10ClN3 |
| Molecular Weight | 267.72 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 11-(4-chlorophenyl)-1,5,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | Clc1ccc(-c2cn3c(ccc4[nH]ccc43)n2)cc1 |
| InChI | InChI=1S/C15H10ClN3/c16-11-3-1-10(2-4-11)13-9-19-14-7-8-17-12(14)5-6-15(19)18-13/h1-9,17H |
| InChIKey | NCOVGFFJACQOQA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.72 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |