C16H17N3O4 — CID 155255124
2-[(3S)-4-(1H-indole-2-carbonyl)-3-methylpiperazin-1-yl]-2-oxoacetic acid (PubChem CID 155255124) has the molecular formula C16H17N3O4 and a molecular weight of 315.33 g/mol. Its IUPAC name is 2-[(3S)-4-(1H-indole-2-carbonyl)-3-methylpiperazin-1-yl]-2-oxoacetic acid.
| Compound Name | 2-[(3S)-4-(1H-indole-2-carbonyl)-3-methylpiperazin-1-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 155255124 |
| Molecular Formula | C16H17N3O4 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 2-[(3S)-4-(1H-indole-2-carbonyl)-3-methylpiperazin-1-yl]-2-oxoacetic acid |
| SMILES | C[C@H]1CN(C(=O)C(=O)O)CCN1C(=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H17N3O4/c1-10-9-18(15(21)16(22)23)6-7-19(10)14(20)13-8-11-4-2-3-5-12(11)17-13/h2-5,8,10,17H,6-7,9H2,1H3,(H,22,23)/t10-/m0/s1 |
| InChIKey | KFTWPJQVELARGV-JTQLQIEISA-N |
| XLogP | 0.93 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|