C15H20N4O — CID 80504727
[2-(aminomethyl)-4-methylpiperazin-1-yl]-(1H-indol-2-yl)methanone (PubChem CID 80504727) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is [2-(aminomethyl)-4-methylpiperazin-1-yl]-(1H-indol-2-yl)methanone.
| Compound Name | [2-(aminomethyl)-4-methylpiperazin-1-yl]-(1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 80504727 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | [2-(aminomethyl)-4-methylpiperazin-1-yl]-(1H-indol-2-yl)methanone |
| SMILES | CN1CCN(C(=O)c2cc3ccccc3[nH]2)C(CN)C1 |
| InChI | InChI=1S/C15H20N4O/c1-18-6-7-19(12(9-16)10-18)15(20)14-8-11-4-2-3-5-13(11)17-14/h2-5,8,12,17H,6-7,9-10,16H2,1H3 |
| InChIKey | HCMVMQVMPGBYKT-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |