C27H27N3O — CID 139757452
[(2S)-2,4-dibenzylpiperazin-1-yl]-(1H-indol-2-yl)methanone (PubChem CID 139757452) has the molecular formula C27H27N3O and a molecular weight of 409.53 g/mol. Its IUPAC name is [(2S)-2,4-dibenzylpiperazin-1-yl]-(1H-indol-2-yl)methanone.
| Compound Name | [(2S)-2,4-dibenzylpiperazin-1-yl]-(1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 139757452 |
| Molecular Formula | C27H27N3O |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | [(2S)-2,4-dibenzylpiperazin-1-yl]-(1H-indol-2-yl)methanone |
| SMILES | O=C(c1cc2ccccc2[nH]1)N1CCN(Cc2ccccc2)C[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C27H27N3O/c31-27(26-18-23-13-7-8-14-25(23)28-26)30-16-15-29(19-22-11-5-2-6-12-22)20-24(30)17-21-9-3-1-4-10-21/h1-14,18,24,28H,15-17,19-20H2/t24-/m0/s1 |
| InChIKey | YBXHGDKCCJWLBN-DEOSSOPVSA-N |
| XLogP | 4.74 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |