C28H26N6O — CID 59690566
N-cyano-4-(1H-indole-2-carbonyl)-N'-(2-methylphenyl)-3-phenylpiperazine-1-carboximidamide (PubChem CID 59690566) has the molecular formula C28H26N6O and a molecular weight of 462.56 g/mol. Its IUPAC name is N-cyano-4-(1H-indole-2-carbonyl)-N'-(2-methylphenyl)-3-phenylpiperazine-1-carboximidamide.
| Compound Name | N-cyano-4-(1H-indole-2-carbonyl)-N'-(2-methylphenyl)-3-phenylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 59690566 |
| Molecular Formula | C28H26N6O |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | N-cyano-4-(1H-indole-2-carbonyl)-N'-(2-methylphenyl)-3-phenylpiperazine-1-carboximidamide |
| SMILES | Cc1ccccc1/N=C(\NC#N)N1CCN(C(=O)c2cc3ccccc3[nH]2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C28H26N6O/c1-20-9-5-7-13-23(20)32-28(30-19-29)33-15-16-34(26(18-33)21-10-3-2-4-11-21)27(35)25-17-22-12-6-8-14-24(22)31-25/h2-14,17,26,31H,15-16,18H2,1H3,(H,30,32) |
| InChIKey | BNVRKIPYXHXXJS-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 87.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|