C25H23ClFN5O2S — CID 59689551
4-(3-chloro-4-fluorophenyl)sulfonyl-N-cyano-N'-(2-methylphenyl)-3-phenylpiperazine-1-carboximidamide (PubChem CID 59689551) has the molecular formula C25H23ClFN5O2S and a molecular weight of 512.01 g/mol. Its IUPAC name is 4-(3-chloro-4-fluorophenyl)sulfonyl-N-cyano-N'-(2-methylphenyl)-3-phenylpiperazine-1-carboximidamide.
| Compound Name | 4-(3-chloro-4-fluorophenyl)sulfonyl-N-cyano-N'-(2-methylphenyl)-3-phenylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 59689551 |
| Molecular Formula | C25H23ClFN5O2S |
| Molecular Weight | 512.01 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | 4-(3-chloro-4-fluorophenyl)sulfonyl-N-cyano-N'-(2-methylphenyl)-3-phenylpiperazine-1-carboximidamide |
| SMILES | Cc1ccccc1/N=C(\NC#N)N1CCN(S(=O)(=O)c2ccc(F)c(Cl)c2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C25H23ClFN5O2S/c1-18-7-5-6-10-23(18)30-25(29-17-28)31-13-14-32(24(16-31)19-8-3-2-4-9-19)35(33,34)20-11-12-22(27)21(26)15-20/h2-12,15,24H,13-14,16H2,1H3,(H,29,30) |
| InChIKey | MPMDLFXJBMVXAO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 88.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.01 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|