C28H28N6O2 — CID 59689740
N-(4-acetylphenyl)-4-[N-cyano-N'-(2-methylphenyl)carbamimidoyl]-2-phenylpiperazine-1-carboxamide (PubChem CID 59689740) has the molecular formula C28H28N6O2 and a molecular weight of 480.57 g/mol. Its IUPAC name is N-(4-acetylphenyl)-4-[N-cyano-N'-(2-methylphenyl)carbamimidoyl]-2-phenylpiperazine-1-carboxamide.
| Compound Name | N-(4-acetylphenyl)-4-[N-cyano-N'-(2-methylphenyl)carbamimidoyl]-2-phenylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 59689740 |
| Molecular Formula | C28H28N6O2 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | N-(4-acetylphenyl)-4-[N-cyano-N'-(2-methylphenyl)carbamimidoyl]-2-phenylpiperazine-1-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)N2CCN(/C(=N/c3ccccc3C)NC#N)CC2c2ccccc2)cc1 |
| InChI | InChI=1S/C28H28N6O2/c1-20-8-6-7-11-25(20)32-27(30-19-29)33-16-17-34(26(18-33)23-9-4-3-5-10-23)28(36)31-24-14-12-22(13-15-24)21(2)35/h3-15,26H,16-18H2,1-2H3,(H,30,32)(H,31,36) |
| InChIKey | VFXSNMAQZJWFPI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 100.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|