C31H33N7O3 — CID 59690198
4-[N-cyano-N'-(2-methylphenyl)carbamimidoyl]-N-[3-(morpholine-4-carbonyl)phenyl]-2-phenylpiperazine-1-carboxamide (PubChem CID 59690198) has the molecular formula C31H33N7O3 and a molecular weight of 551.65 g/mol. Its IUPAC name is 4-[N-cyano-N'-(2-methylphenyl)carbamimidoyl]-N-[3-(morpholine-4-carbonyl)phenyl]-2-phenylpiperazine-1-carboxamide.
| Compound Name | 4-[N-cyano-N'-(2-methylphenyl)carbamimidoyl]-N-[3-(morpholine-4-carbonyl)phenyl]-2-phenylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 59690198 |
| Molecular Formula | C31H33N7O3 |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.26 |
| IUPAC Name | 4-[N-cyano-N'-(2-methylphenyl)carbamimidoyl]-N-[3-(morpholine-4-carbonyl)phenyl]-2-phenylpiperazine-1-carboxamide |
| SMILES | Cc1ccccc1/N=C(\NC#N)N1CCN(C(=O)Nc2cccc(C(=O)N3CCOCC3)c2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C31H33N7O3/c1-23-8-5-6-13-27(23)35-30(33-22-32)37-14-15-38(28(21-37)24-9-3-2-4-10-24)31(40)34-26-12-7-11-25(20-26)29(39)36-16-18-41-19-17-36/h2-13,20,28H,14-19,21H2,1H3,(H,33,35)(H,34,40) |
| InChIKey | AMIQFIXOIQWHOW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|