C27H27ClN6O2 — CID 59690676
N-(5-chloro-2-methoxyphenyl)-4-[N-cyano-N'-(2-methylphenyl)carbamimidoyl]-2-phenylpiperazine-1-carboxamide (PubChem CID 59690676) has the molecular formula C27H27ClN6O2 and a molecular weight of 503.01 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-4-[N-cyano-N'-(2-methylphenyl)carbamimidoyl]-2-phenylpiperazine-1-carboxamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-4-[N-cyano-N'-(2-methylphenyl)carbamimidoyl]-2-phenylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 59690676 |
| Molecular Formula | C27H27ClN6O2 |
| Molecular Weight | 503.01 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-4-[N-cyano-N'-(2-methylphenyl)carbamimidoyl]-2-phenylpiperazine-1-carboxamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)N1CCN(/C(=N/c2ccccc2C)NC#N)CC1c1ccccc1 |
| InChI | InChI=1S/C27H27ClN6O2/c1-19-8-6-7-11-22(19)31-26(30-18-29)33-14-15-34(24(17-33)20-9-4-3-5-10-20)27(35)32-23-16-21(28)12-13-25(23)36-2/h3-13,16,24H,14-15,17H2,1-2H3,(H,30,31)(H,32,35) |
| InChIKey | CPAMZFYXRPZRGG-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 92.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.01 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|