C28H30ClN7O — CID 44567972
N-(4-chlorophenyl)-4-[N-cyano-N'-[2-[(dimethylamino)methyl]phenyl]carbamimidoyl]-2-phenylpiperazine-1-carboxamide (PubChem CID 44567972) has the molecular formula C28H30ClN7O and a molecular weight of 516.05 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[N-cyano-N'-[2-[(dimethylamino)methyl]phenyl]carbamimidoyl]-2-phenylpiperazine-1-carboxamide.
| Compound Name | N-(4-chlorophenyl)-4-[N-cyano-N'-[2-[(dimethylamino)methyl]phenyl]carbamimidoyl]-2-phenylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 44567972 |
| Molecular Formula | C28H30ClN7O |
| Molecular Weight | 516.05 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | N-(4-chlorophenyl)-4-[N-cyano-N'-[2-[(dimethylamino)methyl]phenyl]carbamimidoyl]-2-phenylpiperazine-1-carboxamide |
| SMILES | CN(C)Cc1ccccc1/N=C(\NC#N)N1CCN(C(=O)Nc2ccc(Cl)cc2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C28H30ClN7O/c1-34(2)18-22-10-6-7-11-25(22)33-27(31-20-30)35-16-17-36(26(19-35)21-8-4-3-5-9-21)28(37)32-24-14-12-23(29)13-15-24/h3-15,26H,16-19H2,1-2H3,(H,31,33)(H,32,37) |
| InChIKey | UVEQLXUXABFFME-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.05 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|