C27H27ClN6O — CID 59690699
N-(4-chlorophenyl)-4-[N-cyano-N'-[(2-methylphenyl)methyl]carbamimidoyl]-2-phenylpiperazine-1-carboxamide (PubChem CID 59690699) has the molecular formula C27H27ClN6O and a molecular weight of 487.01 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[N-cyano-N'-[(2-methylphenyl)methyl]carbamimidoyl]-2-phenylpiperazine-1-carboxamide.
| Compound Name | N-(4-chlorophenyl)-4-[N-cyano-N'-[(2-methylphenyl)methyl]carbamimidoyl]-2-phenylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 59690699 |
| Molecular Formula | C27H27ClN6O |
| Molecular Weight | 487.01 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | N-(4-chlorophenyl)-4-[N-cyano-N'-[(2-methylphenyl)methyl]carbamimidoyl]-2-phenylpiperazine-1-carboxamide |
| SMILES | Cc1ccccc1C/N=C(\NC#N)N1CCN(C(=O)Nc2ccc(Cl)cc2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C27H27ClN6O/c1-20-7-5-6-10-22(20)17-30-26(31-19-29)33-15-16-34(25(18-33)21-8-3-2-4-9-21)27(35)32-24-13-11-23(28)12-14-24/h2-14,25H,15-18H2,1H3,(H,30,31)(H,32,35) |
| InChIKey | ZYJIKWDIARFUCN-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 83.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.01 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|