C25H24ClN7O — CID 59689429
N-(4-chlorophenyl)-4-[N-cyano-N'-(2-methyl-3-pyridinyl)carbamimidoyl]-2-phenylpiperazine-1-carboxamide (PubChem CID 59689429) has the molecular formula C25H24ClN7O and a molecular weight of 473.97 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[N-cyano-N'-(2-methyl-3-pyridinyl)carbamimidoyl]-2-phenylpiperazine-1-carboxamide.
| Compound Name | N-(4-chlorophenyl)-4-[N-cyano-N'-(2-methyl-3-pyridinyl)carbamimidoyl]-2-phenylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 59689429 |
| Molecular Formula | C25H24ClN7O |
| Molecular Weight | 473.97 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | N-(4-chlorophenyl)-4-[N-cyano-N'-(2-methyl-3-pyridinyl)carbamimidoyl]-2-phenylpiperazine-1-carboxamide |
| SMILES | Cc1ncccc1/N=C(\NC#N)N1CCN(C(=O)Nc2ccc(Cl)cc2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C25H24ClN7O/c1-18-22(8-5-13-28-18)31-24(29-17-27)32-14-15-33(23(16-32)19-6-3-2-4-7-19)25(34)30-21-11-9-20(26)10-12-21/h2-13,23H,14-16H2,1H3,(H,29,31)(H,30,34) |
| InChIKey | GQTUMJABPGOKCV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 96.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.97 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|