C25H27N5O2S2 — CID 59689981
N-cyano-4-(2,5-dimethylthiophen-3-yl)sulfonyl-N'-(2-methylphenyl)-3-phenylpiperazine-1-carboximidamide (PubChem CID 59689981) has the molecular formula C25H27N5O2S2 and a molecular weight of 493.66 g/mol. Its IUPAC name is N-cyano-4-(2,5-dimethylthiophen-3-yl)sulfonyl-N'-(2-methylphenyl)-3-phenylpiperazine-1-carboximidamide.
| Compound Name | N-cyano-4-(2,5-dimethylthiophen-3-yl)sulfonyl-N'-(2-methylphenyl)-3-phenylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 59689981 |
| Molecular Formula | C25H27N5O2S2 |
| Molecular Weight | 493.66 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | N-cyano-4-(2,5-dimethylthiophen-3-yl)sulfonyl-N'-(2-methylphenyl)-3-phenylpiperazine-1-carboximidamide |
| SMILES | Cc1cc(S(=O)(=O)N2CCN(/C(=N/c3ccccc3C)NC#N)CC2c2ccccc2)c(C)s1 |
| InChI | InChI=1S/C25H27N5O2S2/c1-18-9-7-8-12-22(18)28-25(27-17-26)29-13-14-30(23(16-29)21-10-5-4-6-11-21)34(31,32)24-15-19(2)33-20(24)3/h4-12,15,23H,13-14,16H2,1-3H3,(H,27,28) |
| InChIKey | SEOWOTTYNSARAE-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 88.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.66 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|