C26H26ClN5O2S — CID 59689469
4-(3-chloro-4-methylphenyl)sulfonyl-N-cyano-N'-(2-methylphenyl)-3-phenylpiperazine-1-carboximidamide (PubChem CID 59689469) has the molecular formula C26H26ClN5O2S and a molecular weight of 508.05 g/mol. Its IUPAC name is 4-(3-chloro-4-methylphenyl)sulfonyl-N-cyano-N'-(2-methylphenyl)-3-phenylpiperazine-1-carboximidamide.
| Compound Name | 4-(3-chloro-4-methylphenyl)sulfonyl-N-cyano-N'-(2-methylphenyl)-3-phenylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 59689469 |
| Molecular Formula | C26H26ClN5O2S |
| Molecular Weight | 508.05 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | 4-(3-chloro-4-methylphenyl)sulfonyl-N-cyano-N'-(2-methylphenyl)-3-phenylpiperazine-1-carboximidamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(/C(=N/c3ccccc3C)NC#N)CC2c2ccccc2)cc1Cl |
| InChI | InChI=1S/C26H26ClN5O2S/c1-19-12-13-22(16-23(19)27)35(33,34)32-15-14-31(17-25(32)21-9-4-3-5-10-21)26(29-18-28)30-24-11-7-6-8-20(24)2/h3-13,16,25H,14-15,17H2,1-2H3,(H,29,30) |
| InChIKey | YYVAYLZVEYPJEL-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 88.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.05 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|