C18H21ClN2O2S2 — CID 154800979
1-(3-chloro-4-methylsulfanylphenyl)sulfonyl-4-methyl-2-phenylpiperazine (PubChem CID 154800979) has the molecular formula C18H21ClN2O2S2 and a molecular weight of 396.97 g/mol. Its IUPAC name is 1-(3-chloro-4-methylsulfanylphenyl)sulfonyl-4-methyl-2-phenylpiperazine.
| Compound Name | 1-(3-chloro-4-methylsulfanylphenyl)sulfonyl-4-methyl-2-phenylpiperazine |
|---|---|
| PubChem CID | 154800979 |
| Molecular Formula | C18H21ClN2O2S2 |
| Molecular Weight | 396.97 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 1-(3-chloro-4-methylsulfanylphenyl)sulfonyl-4-methyl-2-phenylpiperazine |
| SMILES | CSc1ccc(S(=O)(=O)N2CCN(C)CC2c2ccccc2)cc1Cl |
| InChI | InChI=1S/C18H21ClN2O2S2/c1-20-10-11-21(17(13-20)14-6-4-3-5-7-14)25(22,23)15-8-9-18(24-2)16(19)12-15/h3-9,12,17H,10-11,13H2,1-2H3 |
| InChIKey | SIJGUBKGSVOLDJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.97 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |