About 1-(3,4-diethoxyphenyl)sulfonyl-4-methyl-2-phenylpiperazine;hydrochloride
1-(3,4-diethoxyphenyl)sulfonyl-4-methyl-2-phenylpiperazine;hydrochloride (PubChem CID 55386395) has the molecular formula C21H29ClN2O4S
and a molecular weight of 440.99 g/mol. Its IUPAC name is 1-(3,4-diethoxyphenyl)sulfonyl-4-methyl-2-phenylpiperazine;hydrochloride.
Molecular Properties
| Compound Name | 1-(3,4-diethoxyphenyl)sulfonyl-4-methyl-2-phenylpiperazine;hydrochloride |
| PubChem CID | 55386395 |
| Molecular Formula | C21H29ClN2O4S |
| Molecular Weight | 440.99 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 1-(3,4-diethoxyphenyl)sulfonyl-4-methyl-2-phenylpiperazine;hydrochloride |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCN(C)CC2c2ccccc2)cc1OCC.Cl |
| InChI | InChI=1S/C21H28N2O4S.ClH/c1-4-26-20-12-11-18(15-21(20)27-5-2)28(24,25)23-14-13-22(3)16-19(23)17-9-7-6-8-10-17;/h6-12,15,19H,4-5,13-14,16H2,1-3H3;1H |
| InChIKey | USFLPVXYYIKXST-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.99 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(3,4-diethoxyphenyl)sulfonyl-4-methyl-2-phenylpiperazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-diethoxyphenyl)sulfonyl-4-methyl-2-phenylpiperazine;hydrochloride?
The IUPAC name of 1-(3,4-diethoxyphenyl)sulfonyl-4-methyl-2-phenylpiperazine;hydrochloride (CID 55386395) is 1-(3,4-diethoxyphenyl)sulfonyl-4-methyl-2-phenylpiperazine;hydrochloride.
What is the SMILES notation for 1-(3,4-diethoxyphenyl)sulfonyl-4-methyl-2-phenylpiperazine;hydrochloride?
The canonical SMILES for 1-(3,4-diethoxyphenyl)sulfonyl-4-methyl-2-phenylpiperazine;hydrochloride is CCOc1ccc(S(=O)(=O)N2CCN(C)CC2c2ccccc2)cc1OCC.Cl.
What is the InChIKey of 1-(3,4-diethoxyphenyl)sulfonyl-4-methyl-2-phenylpiperazine;hydrochloride?
The InChIKey is USFLPVXYYIKXST-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28N2O4S.ClH/c1-4-26-20-12-11-18(15-21(20)27-5-2)28(24,25)23-14-13-22(3)16-19(23)17-9-7-6-8-10-17;/h6-12,15,19H,4-5,13-14,16H2,1-3H3;1H.
What are the key properties of 1-(3,4-diethoxyphenyl)sulfonyl-4-methyl-2-phenylpiperazine;hydrochloride?
1-(3,4-diethoxyphenyl)sulfonyl-4-methyl-2-phenylpiperazine;hydrochloride has a molecular weight of 440.99 g/mol, XLogP of 3.58, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-diethoxyphenyl)sulfonyl-4-methyl-2-phenylpiperazine;hydrochloride is sourced from PubChem (CID 55386395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).