C23H31ClN2O2S — CID 17434921
1-(4-cyclohexylphenyl)sulfonyl-4-methyl-2-phenylpiperazine;hydrochloride (PubChem CID 17434921) has the molecular formula C23H31ClN2O2S and a molecular weight of 435.03 g/mol. Its IUPAC name is 1-(4-cyclohexylphenyl)sulfonyl-4-methyl-2-phenylpiperazine;hydrochloride.
| Compound Name | 1-(4-cyclohexylphenyl)sulfonyl-4-methyl-2-phenylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 17434921 |
| Molecular Formula | C23H31ClN2O2S |
| Molecular Weight | 435.03 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 1-(4-cyclohexylphenyl)sulfonyl-4-methyl-2-phenylpiperazine;hydrochloride |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(C3CCCCC3)cc2)C(c2ccccc2)C1.Cl |
| InChI | InChI=1S/C23H30N2O2S.ClH/c1-24-16-17-25(23(18-24)21-10-6-3-7-11-21)28(26,27)22-14-12-20(13-15-22)19-8-4-2-5-9-19;/h3,6-7,10-15,19,23H,2,4-5,8-9,16-18H2,1H3;1H |
| InChIKey | YBBLWHMPALSAMQ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.03 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |