C17H27N3O2S — CID 43042480
1-(4-methyl-2-phenylpiperazin-1-yl)sulfonylazepane (PubChem CID 43042480) has the molecular formula C17H27N3O2S and a molecular weight of 337.49 g/mol. Its IUPAC name is 1-(4-methyl-2-phenylpiperazin-1-yl)sulfonylazepane.
| Compound Name | 1-(4-methyl-2-phenylpiperazin-1-yl)sulfonylazepane |
|---|---|
| PubChem CID | 43042480 |
| Molecular Formula | C17H27N3O2S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 1-(4-methyl-2-phenylpiperazin-1-yl)sulfonylazepane |
| SMILES | CN1CCN(S(=O)(=O)N2CCCCCC2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C17H27N3O2S/c1-18-13-14-20(17(15-18)16-9-5-4-6-10-16)23(21,22)19-11-7-2-3-8-12-19/h4-6,9-10,17H,2-3,7-8,11-15H2,1H3 |
| InChIKey | VBMFYLCQMFVSLY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |