C35H35N7O3 — CID 59689684
benzyl N-[[3-[[4-[N-cyano-N'-(2-methylphenyl)carbamimidoyl]-2-phenylpiperazine-1-carbonyl]amino]phenyl]methyl]carbamate (PubChem CID 59689684) has the molecular formula C35H35N7O3 and a molecular weight of 601.71 g/mol. Its IUPAC name is benzyl N-[[3-[[4-[N-cyano-N'-(2-methylphenyl)carbamimidoyl]-2-phenylpiperazine-1-carbonyl]amino]phenyl]methyl]carbamate.
| Compound Name | benzyl N-[[3-[[4-[N-cyano-N'-(2-methylphenyl)carbamimidoyl]-2-phenylpiperazine-1-carbonyl]amino]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 59689684 |
| Molecular Formula | C35H35N7O3 |
| Molecular Weight | 601.71 g/mol |
| Exact Mass | 601.28 |
| IUPAC Name | benzyl N-[[3-[[4-[N-cyano-N'-(2-methylphenyl)carbamimidoyl]-2-phenylpiperazine-1-carbonyl]amino]phenyl]methyl]carbamate |
| SMILES | Cc1ccccc1/N=C(\NC#N)N1CCN(C(=O)Nc2cccc(CNC(=O)OCc3ccccc3)c2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C35H35N7O3/c1-26-11-8-9-18-31(26)40-33(38-25-36)41-19-20-42(32(23-41)29-15-6-3-7-16-29)34(43)39-30-17-10-14-28(21-30)22-37-35(44)45-24-27-12-4-2-5-13-27/h2-18,21,32H,19-20,22-24H2,1H3,(H,37,44)(H,38,40)(H,39,43) |
| InChIKey | UTLHGPSLOJQWIU-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.71 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|