C22H23ClN6O — CID 59690377
N-(4-chlorophenyl)-7-[N-cyano-N'-(2-methylphenyl)carbamimidoyl]-4,7-diazaspiro[2.5]octane-4-carboxamide (PubChem CID 59690377) has the molecular formula C22H23ClN6O and a molecular weight of 422.92 g/mol. Its IUPAC name is N-(4-chlorophenyl)-7-[N-cyano-N'-(2-methylphenyl)carbamimidoyl]-4,7-diazaspiro[2.5]octane-4-carboxamide.
| Compound Name | N-(4-chlorophenyl)-7-[N-cyano-N'-(2-methylphenyl)carbamimidoyl]-4,7-diazaspiro[2.5]octane-4-carboxamide |
|---|---|
| PubChem CID | 59690377 |
| Molecular Formula | C22H23ClN6O |
| Molecular Weight | 422.92 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | N-(4-chlorophenyl)-7-[N-cyano-N'-(2-methylphenyl)carbamimidoyl]-4,7-diazaspiro[2.5]octane-4-carboxamide |
| SMILES | Cc1ccccc1/N=C(\NC#N)N1CCN(C(=O)Nc2ccc(Cl)cc2)C2(CC2)C1 |
| InChI | InChI=1S/C22H23ClN6O/c1-16-4-2-3-5-19(16)27-20(25-15-24)28-12-13-29(22(14-28)10-11-22)21(30)26-18-8-6-17(23)7-9-18/h2-9H,10-14H2,1H3,(H,25,27)(H,26,30) |
| InChIKey | UVNVCMRKIJFIAL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 83.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.92 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|