C21H33NO7 — CID 155255394
(2S)-1-[2-(2-methylidene-4-octoxy-4-oxobutanoyl)oxypropanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 155255394) has the molecular formula C21H33NO7 and a molecular weight of 411.50 g/mol. Its IUPAC name is (2S)-1-[2-(2-methylidene-4-octoxy-4-oxobutanoyl)oxypropanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[2-(2-methylidene-4-octoxy-4-oxobutanoyl)oxypropanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 155255394 |
| Molecular Formula | C21H33NO7 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | (2S)-1-[2-(2-methylidene-4-octoxy-4-oxobutanoyl)oxypropanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | C=C(CC(=O)OCCCCCCCC)C(=O)OC(C)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C21H33NO7/c1-4-5-6-7-8-9-13-28-18(23)14-15(2)21(27)29-16(3)19(24)22-12-10-11-17(22)20(25)26/h16-17H,2,4-14H2,1,3H3,(H,25,26)/t16?,17-/m0/s1 |
| InChIKey | MIZOMCJDCPUFKR-DJNXLDHESA-N |
| XLogP | 2.84 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|