C34H57BrO12 — CID 167533250
1-O-(1-acetyloxyethyl) 4-O-octyl 2-methylidenebutanedioate;1-bromoethyl acetate;2-methylidene-4-octoxy-4-oxobutanoic acid (PubChem CID 167533250) has the molecular formula C34H57BrO12 and a molecular weight of 737.72 g/mol. Its IUPAC name is 1-O-(1-acetyloxyethyl) 4-O-octyl 2-methylidenebutanedioate;1-bromoethyl acetate;2-methylidene-4-octoxy-4-oxobutanoic acid.
| Compound Name | 1-O-(1-acetyloxyethyl) 4-O-octyl 2-methylidenebutanedioate;1-bromoethyl acetate;2-methylidene-4-octoxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 167533250 |
| Molecular Formula | C34H57BrO12 |
| Molecular Weight | 737.72 g/mol |
| Exact Mass | 736.30 |
| IUPAC Name | 1-O-(1-acetyloxyethyl) 4-O-octyl 2-methylidenebutanedioate;1-bromoethyl acetate;2-methylidene-4-octoxy-4-oxobutanoic acid |
| SMILES | C=C(CC(=O)OCCCCCCCC)C(=O)O.C=C(CC(=O)OCCCCCCCC)C(=O)OC(C)OC(C)=O.CC(=O)OC(C)Br |
| InChI | InChI=1S/C17H28O6.C13H22O4.C4H7BrO2/c1-5-6-7-8-9-10-11-21-16(19)12-13(2)17(20)23-15(4)22-14(3)18;1-3-4-5-6-7-8-9-17-12(14)10-11(2)13(15)16;1-3(5)7-4(2)6/h15H,2,5-12H2,1,3-4H3;2-10H2,1H3,(H,15,16);3H,1-2H3 |
| InChIKey | AGFFIPNDSFVDTJ-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 168.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.72 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|