C18H26N4O3S — CID 155255495
tert-butyl 7a-pyrrolidin-1-yl-3-(1,3-thiazol-4-yl)-3a,4,6,7-tetrahydro-[1,2]oxazolo[4,5-c]pyridine-5-carboxylate (PubChem CID 155255495) has the molecular formula C18H26N4O3S and a molecular weight of 378.50 g/mol. Its IUPAC name is tert-butyl 7a-pyrrolidin-1-yl-3-(1,3-thiazol-4-yl)-3a,4,6,7-tetrahydro-[1,2]oxazolo[4,5-c]pyridine-5-carboxylate.
| Compound Name | tert-butyl 7a-pyrrolidin-1-yl-3-(1,3-thiazol-4-yl)-3a,4,6,7-tetrahydro-[1,2]oxazolo[4,5-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 155255495 |
| Molecular Formula | C18H26N4O3S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | tert-butyl 7a-pyrrolidin-1-yl-3-(1,3-thiazol-4-yl)-3a,4,6,7-tetrahydro-[1,2]oxazolo[4,5-c]pyridine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(N3CCCC3)ON=C(c3cscn3)C2C1 |
| InChI | InChI=1S/C18H26N4O3S/c1-17(2,3)24-16(23)21-9-6-18(22-7-4-5-8-22)13(10-21)15(20-25-18)14-11-26-12-19-14/h11-13H,4-10H2,1-3H3 |
| InChIKey | QDIPQNGQGALJLG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 67.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |