C28H23BrN2O5 — CID 155256525
3-bromo-1-[(2,4-dimethoxyphenyl)methyl]-4-(6-phenylmethoxy-1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 155256525) has the molecular formula C28H23BrN2O5 and a molecular weight of 547.41 g/mol. Its IUPAC name is 3-bromo-1-[(2,4-dimethoxyphenyl)methyl]-4-(6-phenylmethoxy-1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-bromo-1-[(2,4-dimethoxyphenyl)methyl]-4-(6-phenylmethoxy-1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 155256525 |
| Molecular Formula | C28H23BrN2O5 |
| Molecular Weight | 547.41 g/mol |
| Exact Mass | 546.08 |
| IUPAC Name | 3-bromo-1-[(2,4-dimethoxyphenyl)methyl]-4-(6-phenylmethoxy-1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | COc1ccc(CN2C(=O)C(Br)=C(c3c[nH]c4cc(OCc5ccccc5)ccc34)C2=O)c(OC)c1 |
| InChI | InChI=1S/C28H23BrN2O5/c1-34-19-9-8-18(24(13-19)35-2)15-31-27(32)25(26(29)28(31)33)22-14-30-23-12-20(10-11-21(22)23)36-16-17-6-4-3-5-7-17/h3-14,30H,15-16H2,1-2H3 |
| InChIKey | JJFCKKYODCQZDB-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 80.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.41 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|