C32H27N3O5 — CID 175230704
1-[(2,4-dimethoxyphenyl)methyl]-3-(6-phenylmethoxy-1H-indol-3-yl)-4-(1H-pyrrol-3-yl)pyrrole-2,5-dione (PubChem CID 175230704) has the molecular formula C32H27N3O5 and a molecular weight of 533.58 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methyl]-3-(6-phenylmethoxy-1H-indol-3-yl)-4-(1H-pyrrol-3-yl)pyrrole-2,5-dione.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methyl]-3-(6-phenylmethoxy-1H-indol-3-yl)-4-(1H-pyrrol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 175230704 |
| Molecular Formula | C32H27N3O5 |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methyl]-3-(6-phenylmethoxy-1H-indol-3-yl)-4-(1H-pyrrol-3-yl)pyrrole-2,5-dione |
| SMILES | COc1ccc(CN2C(=O)C(c3cc[nH]c3)=C(c3c[nH]c4cc(OCc5ccccc5)ccc34)C2=O)c(OC)c1 |
| InChI | InChI=1S/C32H27N3O5/c1-38-23-9-8-22(28(15-23)39-2)18-35-31(36)29(21-12-13-33-16-21)30(32(35)37)26-17-34-27-14-24(10-11-25(26)27)40-19-20-6-4-3-5-7-20/h3-17,33-34H,18-19H2,1-2H3 |
| InChIKey | SXJFNRVDAYOWLG-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 96.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|