C12H14O5 — CID 15525817
(4aR,5S,8aR)-5-hydroxy-8a-(hydroxymethyl)-3-methoxy-5,8-dihydro-4aH-naphthalene-1,4-dione (PubChem CID 15525817) has the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. Its IUPAC name is (4aR,5S,8aR)-5-hydroxy-8a-(hydroxymethyl)-3-methoxy-5,8-dihydro-4aH-naphthalene-1,4-dione.
| Compound Name | (4aR,5S,8aR)-5-hydroxy-8a-(hydroxymethyl)-3-methoxy-5,8-dihydro-4aH-naphthalene-1,4-dione |
|---|---|
| PubChem CID | 15525817 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | (4aR,5S,8aR)-5-hydroxy-8a-(hydroxymethyl)-3-methoxy-5,8-dihydro-4aH-naphthalene-1,4-dione |
| SMILES | COC1=CC(=O)[C@]2(CO)CC=C[C@H](O)[C@@H]2C1=O |
| InChI | InChI=1S/C12H14O5/c1-17-8-5-9(15)12(6-13)4-2-3-7(14)10(12)11(8)16/h2-3,5,7,10,13-14H,4,6H2,1H3/t7-,10+,12+/m0/s1 |
| InChIKey | KKUVCKAJCWKHQN-HNBZJPLGSA-N |
| XLogP | -0.42 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|