C22H16O6 — CID 102585768
6,18-dimethoxyheptacyclo[10.8.0.01,17.02,11.05,9.09,14.010,13]icosa-4,6,16,18-tetraene-3,8,15,20-tetrone (PubChem CID 102585768) has the molecular formula C22H16O6 and a molecular weight of 376.36 g/mol. Its IUPAC name is 6,18-dimethoxyheptacyclo[10.8.0.01,17.02,11.05,9.09,14.010,13]icosa-4,6,16,18-tetraene-3,8,15,20-tetrone.
| Compound Name | 6,18-dimethoxyheptacyclo[10.8.0.01,17.02,11.05,9.09,14.010,13]icosa-4,6,16,18-tetraene-3,8,15,20-tetrone |
|---|---|
| PubChem CID | 102585768 |
| Molecular Formula | C22H16O6 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 6,18-dimethoxyheptacyclo[10.8.0.01,17.02,11.05,9.09,14.010,13]icosa-4,6,16,18-tetraene-3,8,15,20-tetrone |
| SMILES | COC1=CC(=O)C23C1=CC(=O)C1C4C2C2C3C(=O)C=C3C(OC)=CC(=O)C31C24 |
| InChI | InChI=1S/C22H16O6/c1-27-11-5-13(25)21-7(11)3-9(23)18-16-19(21)15-17(21)10(24)4-8-12(28-2)6-14(26)22(8,18)20(15)16/h3-6,15-20H,1-2H3 |
| InChIKey | VHIQWGDHSQXUIZ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |