C14H18O5 — CID 135010545
(4aS,5R,8aR)-8a-(2-hydroxyethyl)-3,5-dimethoxy-5,8-dihydro-4aH-naphthalene-1,4-dione (PubChem CID 135010545) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is (4aS,5R,8aR)-8a-(2-hydroxyethyl)-3,5-dimethoxy-5,8-dihydro-4aH-naphthalene-1,4-dione.
| Compound Name | (4aS,5R,8aR)-8a-(2-hydroxyethyl)-3,5-dimethoxy-5,8-dihydro-4aH-naphthalene-1,4-dione |
|---|---|
| PubChem CID | 135010545 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | (4aS,5R,8aR)-8a-(2-hydroxyethyl)-3,5-dimethoxy-5,8-dihydro-4aH-naphthalene-1,4-dione |
| SMILES | COC1=CC(=O)[C@@]2(CCO)CC=C[C@@H](OC)[C@H]2C1=O |
| InChI | InChI=1S/C14H18O5/c1-18-9-4-3-5-14(6-7-15)11(16)8-10(19-2)13(17)12(9)14/h3-4,8-9,12,15H,5-7H2,1-2H3/t9-,12+,14+/m1/s1 |
| InChIKey | XZEUVMDCKPJVCF-LQJRIPTKSA-N |
| XLogP | 0.63 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|