C20H26O5 — CID 5314113
[(9R)-6-methoxy-1,1,4a-trimethyl-5,8-dioxo-2,3,4,4b,8a,9-hexahydrophenanthren-9-yl] acetate (PubChem CID 5314113) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is [(9R)-6-methoxy-1,1,4a-trimethyl-5,8-dioxo-2,3,4,4b,8a,9-hexahydrophenanthren-9-yl] acetate.
| Compound Name | [(9R)-6-methoxy-1,1,4a-trimethyl-5,8-dioxo-2,3,4,4b,8a,9-hexahydrophenanthren-9-yl] acetate |
|---|---|
| PubChem CID | 5314113 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | [(9R)-6-methoxy-1,1,4a-trimethyl-5,8-dioxo-2,3,4,4b,8a,9-hexahydrophenanthren-9-yl] acetate |
| SMILES | COC1=CC(=O)C2C(C1=O)C1(C)CCCC(C)(C)C1=C[C@H]2OC(C)=O |
| InChI | InChI=1S/C20H26O5/c1-11(21)25-13-10-15-19(2,3)7-6-8-20(15,4)17-16(13)12(22)9-14(24-5)18(17)23/h9-10,13,16-17H,6-8H2,1-5H3/t13-,16?,17?,20?/m1/s1 |
| InChIKey | WTKSATNUHCNTFU-KSMRAORZSA-N |
| XLogP | 2.99 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|