C19H13F6N3O2 — CID 155258550
(Z)-N-[1-[2,4-bis(trifluoromethyl)phenyl]-3-methylpyrazol-4-yl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 155258550) has the molecular formula C19H13F6N3O2 and a molecular weight of 429.32 g/mol. Its IUPAC name is (Z)-N-[1-[2,4-bis(trifluoromethyl)phenyl]-3-methylpyrazol-4-yl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (Z)-N-[1-[2,4-bis(trifluoromethyl)phenyl]-3-methylpyrazol-4-yl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 155258550 |
| Molecular Formula | C19H13F6N3O2 |
| Molecular Weight | 429.32 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | (Z)-N-[1-[2,4-bis(trifluoromethyl)phenyl]-3-methylpyrazol-4-yl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | Cc1nn(-c2ccc(C(F)(F)F)cc2C(F)(F)F)cc1NC(=O)/C=C\c1ccco1 |
| InChI | InChI=1S/C19H13F6N3O2/c1-11-15(26-17(29)7-5-13-3-2-8-30-13)10-28(27-11)16-6-4-12(18(20,21)22)9-14(16)19(23,24)25/h2-10H,1H3,(H,26,29)/b7-5- |
| InChIKey | AWTFAHIIAOVNFW-ALCCZGGFSA-N |
| XLogP | 5.46 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.32 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|