C24H24O4 — CID 155259582
[4-[(2E,3Z)-2-ethylidene-5-methylhexa-3,5-dienoyl]oxy-3-methylphenyl] 4-methylbenzoate (PubChem CID 155259582) has the molecular formula C24H24O4 and a molecular weight of 376.45 g/mol. Its IUPAC name is [4-[(2E,3Z)-2-ethylidene-5-methylhexa-3,5-dienoyl]oxy-3-methylphenyl] 4-methylbenzoate.
| Compound Name | [4-[(2E,3Z)-2-ethylidene-5-methylhexa-3,5-dienoyl]oxy-3-methylphenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 155259582 |
| Molecular Formula | C24H24O4 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | [4-[(2E,3Z)-2-ethylidene-5-methylhexa-3,5-dienoyl]oxy-3-methylphenyl] 4-methylbenzoate |
| SMILES | C=C(C)/C=C\C(=C/C)C(=O)Oc1ccc(OC(=O)c2ccc(C)cc2)cc1C |
| InChI | InChI=1S/C24H24O4/c1-6-19(10-7-16(2)3)23(25)28-22-14-13-21(15-18(22)5)27-24(26)20-11-8-17(4)9-12-20/h6-15H,2H2,1,3-5H3/b10-7-,19-6+ |
| InChIKey | MEQSVIQBWAFDNH-CZLKUVMSSA-N |
| XLogP | 5.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|