C19H20F3N3O2 — CID 155259832
(3S,4S)-4-[3-(difluoromethyl)-1-methylcyclohexa-2,4-dien-1-yl]-N-(6-fluoro-2-pyridinyl)-1-methyl-2-oxopyrrolidine-3-carboxamide (PubChem CID 155259832) has the molecular formula C19H20F3N3O2 and a molecular weight of 379.38 g/mol. Its IUPAC name is (3S,4S)-4-[3-(difluoromethyl)-1-methylcyclohexa-2,4-dien-1-yl]-N-(6-fluoro-2-pyridinyl)-1-methyl-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S,4S)-4-[3-(difluoromethyl)-1-methylcyclohexa-2,4-dien-1-yl]-N-(6-fluoro-2-pyridinyl)-1-methyl-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 155259832 |
| Molecular Formula | C19H20F3N3O2 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | (3S,4S)-4-[3-(difluoromethyl)-1-methylcyclohexa-2,4-dien-1-yl]-N-(6-fluoro-2-pyridinyl)-1-methyl-2-oxopyrrolidine-3-carboxamide |
| SMILES | CN1C[C@H](C2(C)C=C(C(F)F)C=CC2)[C@@H](C(=O)Nc2cccc(F)n2)C1=O |
| InChI | InChI=1S/C19H20F3N3O2/c1-19(8-4-5-11(9-19)16(21)22)12-10-25(2)18(27)15(12)17(26)24-14-7-3-6-13(20)23-14/h3-7,9,12,15-16H,8,10H2,1-2H3,(H,23,24,26)/t12-,15-,19?/m0/s1 |
| InChIKey | AWQFVLDDUKVWOC-OKNGLOLHSA-N |
| XLogP | 3.02 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|